C12H20O5 — CID 159848243
(2R)-2-[(2R,4S)-2-ethyloxan-4-yl]-4-methoxy-4-oxobutanoic acid (PubChem CID 159848243) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2R)-2-[(2R,4S)-2-ethyloxan-4-yl]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2R)-2-[(2R,4S)-2-ethyloxan-4-yl]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 159848243 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (2R)-2-[(2R,4S)-2-ethyloxan-4-yl]-4-methoxy-4-oxobutanoic acid |
| SMILES | CC[C@@H]1C[C@@H]([C@@H](CC(=O)OC)C(=O)O)CCO1 |
| InChI | InChI=1S/C12H20O5/c1-3-9-6-8(4-5-17-9)10(12(14)15)7-11(13)16-2/h8-10H,3-7H2,1-2H3,(H,14,15)/t8-,9+,10+/m0/s1 |
| InChIKey | FXULBMRWFFRPIR-IVZWLZJFSA-N |
| XLogP | 1.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |