C30H25N3O3S — CID 158020674
(E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-[3-[(3-methylphenyl)sulfonylmethyl]phenyl]prop-2-enamide (PubChem CID 158020674) has the molecular formula C30H25N3O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is (E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-[3-[(3-methylphenyl)sulfonylmethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-[3-[(3-methylphenyl)sulfonylmethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 158020674 |
| Molecular Formula | C30H25N3O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-[3-[(3-methylphenyl)sulfonylmethyl]phenyl]prop-2-enamide |
| SMILES | Cc1cccc(S(=O)(=O)Cc2cccc(/C=C/C(=O)Nc3ccccc3-c3nc4ccccc4[nH]3)c2)c1 |
| InChI | InChI=1S/C30H25N3O3S/c1-21-8-6-11-24(18-21)37(35,36)20-23-10-7-9-22(19-23)16-17-29(34)31-26-13-3-2-12-25(26)30-32-27-14-4-5-15-28(27)33-30/h2-19H,20H2,1H3,(H,31,34)(H,32,33)/b17-16+ |
| InChIKey | FGAGRHKTDJXFFD-WUKNDPDISA-N |
| XLogP | 6.16 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|