C23H16N4OS — CID 134059388
(E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 134059388) has the molecular formula C23H16N4OS and a molecular weight of 396.48 g/mol. Its IUPAC name is (E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134059388 |
| Molecular Formula | C23H16N4OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (E)-N-[2-(1H-benzimidazol-2-yl)phenyl]-3-(1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Nc1ccccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H16N4OS/c28-21(13-14-22-25-19-11-5-6-12-20(19)29-22)24-16-8-2-1-7-15(16)23-26-17-9-3-4-10-18(17)27-23/h1-14H,(H,24,28)(H,26,27)/b14-13+ |
| InChIKey | KPQITDLVBQAPPY-BUHFOSPRSA-N |
| XLogP | 5.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|