C48H30O9 — CID 158025600
9-naphtho[2,3-b][1]benzofuran-1-yl-10-[2-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 158025600) has the molecular formula C48H30O9 and a molecular weight of 750.76 g/mol. Its IUPAC name is 9-naphtho[2,3-b][1]benzofuran-1-yl-10-[2-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-naphtho[2,3-b][1]benzofuran-1-yl-10-[2-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 158025600 |
| Molecular Formula | C48H30O9 |
| Molecular Weight | 750.76 g/mol |
| Exact Mass | 750.19 |
| IUPAC Name | 9-naphtho[2,3-b][1]benzofuran-1-yl-10-[2-(4-phenylphenyl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | Oc1c(O)c(O)c2c(-c3cccc4oc5cc6ccccc6cc5c34)c3c(O)c(O)c(O)c(O)c3c(-c3ccccc3-c3ccc(-c4ccccc4)cc3)c2c1O |
| InChI | InChI=1S/C48H30O9/c49-41-37-35(29-14-7-6-13-28(29)25-19-17-24(18-20-25)23-9-2-1-3-10-23)38-40(44(52)48(56)46(54)42(38)50)36(39(37)43(51)47(55)45(41)53)30-15-8-16-32-34(30)31-21-26-11-4-5-12-27(26)22-33(31)57-32/h1-22,49-56H |
| InChIKey | HWVAUOYXHJWJFF-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.76 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|