C10H17F5O3 — CID 158026669
2-(3,3,4,4,4-pentafluorobutoxymethyl)pentane-1,2-diol (PubChem CID 158026669) has the molecular formula C10H17F5O3 and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-(3,3,4,4,4-pentafluorobutoxymethyl)pentane-1,2-diol.
| Compound Name | 2-(3,3,4,4,4-pentafluorobutoxymethyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 158026669 |
| Molecular Formula | C10H17F5O3 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-(3,3,4,4,4-pentafluorobutoxymethyl)pentane-1,2-diol |
| SMILES | CCCC(O)(CO)COCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H17F5O3/c1-2-3-8(17,6-16)7-18-5-4-9(11,12)10(13,14)15/h16-17H,2-7H2,1H3 |
| InChIKey | OUNOWICGDZHYFB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|