C37H42FN9O2 — CID 158027528
1-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(4-cyclobutylpiperazin-1-yl)-2-isocyano-4-methylpent-2-en-1-one (PubChem CID 158027528) has the molecular formula C37H42FN9O2 and a molecular weight of 663.80 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(4-cyclobutylpiperazin-1-yl)-2-isocyano-4-methylpent-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(4-cyclobutylpiperazin-1-yl)-2-isocyano-4-methylpent-2-en-1-one |
|---|---|
| PubChem CID | 158027528 |
| Molecular Formula | C37H42FN9O2 |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.34 |
| IUPAC Name | 1-[3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(4-cyclobutylpiperazin-1-yl)-2-isocyano-4-methylpent-2-en-1-one |
| SMILES | [C-]#[N+]C(=CC(C)(C)N1CCN(C2CCC2)CC1)C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C37H42FN9O2/c1-37(2,46-19-17-44(18-20-46)25-9-7-10-25)22-31(40-3)36(48)45-16-8-11-26(23-45)47-35-32(34(39)41-24-42-35)33(43-47)29-15-14-28(21-30(29)38)49-27-12-5-4-6-13-27/h4-6,12-15,21-22,24-26H,7-11,16-20,23H2,1-2H3,(H2,39,41,42) |
| InChIKey | OEDWGNXJVZKELQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|