About 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate
2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate (PubChem CID 158030589) has the molecular formula C14H14F3IO3S
and a molecular weight of 446.23 g/mol. Its IUPAC name is 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate.
Molecular Properties
| Compound Name | 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate |
| PubChem CID | 158030589 |
| Molecular Formula | C14H14F3IO3S |
| Molecular Weight | 446.23 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate |
| SMILES | FC(F)(F)[s+]1c(C2CCCC2)cc2ccccc21.[O-][I+2]([O-])[O-] |
| InChI | InChI=1S/C14H14F3S.IO3/c15-14(16,17)18-12-8-4-3-7-11(12)9-13(18)10-5-1-2-6-10;2-1(3)4/h3-4,7-10H,1-2,5-6H2;/q+1;-1 |
| InChIKey | FHDCLVGWSCAQAZ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate?
The IUPAC name of 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate (CID 158030589) is 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate.
What is the SMILES notation for 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate?
The canonical SMILES for 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate is FC(F)(F)[s+]1c(C2CCCC2)cc2ccccc21.[O-][I+2]([O-])[O-].
What is the InChIKey of 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate?
The InChIKey is FHDCLVGWSCAQAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3S.IO3/c15-14(16,17)18-12-8-4-3-7-11(12)9-13(18)10-5-1-2-6-10;2-1(3)4/h3-4,7-10H,1-2,5-6H2;/q+1;-1.
What are the key properties of 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate?
2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate has a molecular weight of 446.23 g/mol, XLogP of -0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-1-(trifluoromethyl)-1-benzothiophen-1-ium iodate is sourced from PubChem (CID 158030589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).