About 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one
1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one (PubChem CID 158031966) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one.
Analyze 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one?
The IUPAC name of 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one (CID 158031966) is 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one?
The canonical SMILES for 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one is CC(C)C(=O)C1C=NCC1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one?
The InChIKey is CCZBBWKKOKGWJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-6(2)8(10)7-3-4-9-5-7/h5-7H,3-4H2,1-2H3.
What are the key properties of 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one?
1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one has a molecular weight of 139.20 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyrrol-4-yl)-2-methylpropan-1-one is sourced from PubChem (CID 158031966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).