C8H13NO — CID 91192071
6-ethyl-4-methyl-3,4-dihydro-2H-pyridin-5-one (PubChem CID 91192071) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 6-ethyl-4-methyl-3,4-dihydro-2H-pyridin-5-one.
| Compound Name | 6-ethyl-4-methyl-3,4-dihydro-2H-pyridin-5-one |
|---|---|
| PubChem CID | 91192071 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 6-ethyl-4-methyl-3,4-dihydro-2H-pyridin-5-one |
| SMILES | CCC1=NCCC(C)C1=O |
| InChI | InChI=1S/C8H13NO/c1-3-7-8(10)6(2)4-5-9-7/h6H,3-5H2,1-2H3 |
| InChIKey | HFHHITJCMZOFCT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |