C29H35N3O4 — CID 158033827
2-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone (PubChem CID 158033827) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone.
| Compound Name | 2-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 158033827 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1-(5-ethynyl-1H-imidazol-2-yl)ethanone |
| SMILES | C#Cc1cnc(C(=O)Cc2ccc(C3C[C@@]4(C)O[C@@](C)(C3)[C@H](O)[C@@H]4O)nc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C29H35N3O4/c1-6-20-16-30-26(31-20)22(33)13-18-7-8-21(32-23(18)17-9-11-27(2,3)12-10-17)19-14-28(4)24(34)25(35)29(5,15-19)36-28/h1,7-9,16,19,24-25,34-35H,10-15H2,2-5H3,(H,30,31)/t19?,24-,25+,28+,29- |
| InChIKey | HJBNINCUNWVKIK-TYKHGIDNSA-N |
| XLogP | 3.95 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|