C45H43F2N3O5 — CID 158034690
4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(9H-fluoren-3-yl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one (PubChem CID 158034690) has the molecular formula C45H43F2N3O5 and a molecular weight of 743.85 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(9H-fluoren-3-yl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(9H-fluoren-3-yl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 158034690 |
| Molecular Formula | C45H43F2N3O5 |
| Molecular Weight | 743.85 g/mol |
| Exact Mass | 743.32 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(9H-fluoren-3-yl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
| SMILES | COc1ccc(-c2nc(-c3ccc4c(c3)-c3ccccc3C4)n(Cc3ccc(C(=O)CCCOCCOCCN)cc3)c2-c2ccc(OC)cc2F)c(F)c1 |
| InChI | InChI=1S/C45H43F2N3O5/c1-52-34-15-17-37(40(46)26-34)43-44(38-18-16-35(53-2)27-41(38)47)50(45(49-43)33-14-13-32-24-31-6-3-4-7-36(31)39(32)25-33)28-29-9-11-30(12-10-29)42(51)8-5-20-54-22-23-55-21-19-48/h3-4,6-7,9-18,25-27H,5,8,19-24,28,48H2,1-2H3 |
| InChIKey | LKKBFOMJPRPMHY-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.85 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|