C54H45BCl2IN6O10S2 — CID 158036900
CID 158036900 (PubChem CID 158036900) has the molecular formula C54H45BCl2IN6O10S2 and a molecular weight of 1210.74 g/mol.
| Compound Name | CID 158036900 |
|---|---|
| PubChem CID | 158036900 |
| Molecular Formula | C54H45BCl2IN6O10S2 |
| Molecular Weight | 1210.74 g/mol |
| Exact Mass | 1209.12 |
| IUPAC Name | — |
| SMILES | COc1cc(-c2ncnc3cc(S(=O)(=O)Cc4ccon4)ccc23)c(C)cc1-c1ccc(Cl)c(C)c1.COc1cc(-c2ncnc3cc(S(=O)(=O)Cc4ccon4)ccc23)c(C)cc1I.Cc1cc(O[B]O)ccc1Cl |
| InChI | InChI=1S/C27H22ClN3O4S.C20H16IN3O4S.C7H7BClO2/c1-16-11-23(18-4-7-24(28)17(2)10-18)26(34-3)13-22(16)27-21-6-5-20(12-25(21)29-15-30-27)36(32,33)14-19-8-9-35-31-19;1-12-7-17(21)19(27-2)9-16(12)20-15-4-3-14(8-18(15)22-11-23-20)29(25,26)10-13-5-6-28-24-13;1-5-4-6(11-8-10)2-3-7(5)9/h4-13,15H,14H2,1-3H3;3-9,11H,10H2,1-2H3;2-4,10H,1H3 |
| InChIKey | RXYOKKPKLOLQPN-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 219.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1210.74 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|