C28H24ClFN3O4PS — CID 159025210
1-[4-(4-chloro-3-methylphenyl)-5-fluoro-2-methoxyphenyl]-6-(pyrazin-2-ylmethylsulfonyl)quinolin-2-one;phosphane (PubChem CID 159025210) has the molecular formula C28H24ClFN3O4PS and a molecular weight of 584.01 g/mol. Its IUPAC name is 1-[4-(4-chloro-3-methylphenyl)-5-fluoro-2-methoxyphenyl]-6-(pyrazin-2-ylmethylsulfonyl)quinolin-2-one;phosphane.
| Compound Name | 1-[4-(4-chloro-3-methylphenyl)-5-fluoro-2-methoxyphenyl]-6-(pyrazin-2-ylmethylsulfonyl)quinolin-2-one;phosphane |
|---|---|
| PubChem CID | 159025210 |
| Molecular Formula | C28H24ClFN3O4PS |
| Molecular Weight | 584.01 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | 1-[4-(4-chloro-3-methylphenyl)-5-fluoro-2-methoxyphenyl]-6-(pyrazin-2-ylmethylsulfonyl)quinolin-2-one;phosphane |
| SMILES | COc1cc(-c2ccc(Cl)c(C)c2)c(F)cc1-n1c(=O)ccc2cc(S(=O)(=O)Cc3cnccn3)ccc21.P |
| InChI | InChI=1S/C28H21ClFN3O4S.H3P/c1-17-11-18(3-6-23(17)29)22-13-27(37-2)26(14-24(22)30)33-25-7-5-21(12-19(25)4-8-28(33)34)38(35,36)16-20-15-31-9-10-32-20;/h3-15H,16H2,1-2H3;1H3 |
| InChIKey | JUESRQIVLPDKFG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.01 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|