C34H56N5O6+ — CID 158037610
[(5R,8S)-5-[[(2S,5R)-5-carbamoyl-7-methyl-3-oxo-1-phenyloctan-2-yl]carbamoyl]-9-hydroxy-7-oxo-8-[[(2S)-pyrrolidine-2-carbonyl]amino]nonyl]-trimethylazanium (PubChem CID 158037610) has the molecular formula C34H56N5O6+ and a molecular weight of 630.85 g/mol. Its IUPAC name is [(5R,8S)-5-[[(2S,5R)-5-carbamoyl-7-methyl-3-oxo-1-phenyloctan-2-yl]carbamoyl]-9-hydroxy-7-oxo-8-[[(2S)-pyrrolidine-2-carbonyl]amino]nonyl]-trimethylazanium.
| Compound Name | [(5R,8S)-5-[[(2S,5R)-5-carbamoyl-7-methyl-3-oxo-1-phenyloctan-2-yl]carbamoyl]-9-hydroxy-7-oxo-8-[[(2S)-pyrrolidine-2-carbonyl]amino]nonyl]-trimethylazanium |
|---|---|
| PubChem CID | 158037610 |
| Molecular Formula | C34H56N5O6+ |
| Molecular Weight | 630.85 g/mol |
| Exact Mass | 630.42 |
| IUPAC Name | [(5R,8S)-5-[[(2S,5R)-5-carbamoyl-7-methyl-3-oxo-1-phenyloctan-2-yl]carbamoyl]-9-hydroxy-7-oxo-8-[[(2S)-pyrrolidine-2-carbonyl]amino]nonyl]-trimethylazanium |
| SMILES | CC(C)C[C@H](CC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCC[N+](C)(C)C)CC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1)C(N)=O |
| InChI | InChI=1S/C34H55N5O6/c1-23(2)18-26(32(35)43)21-30(41)28(19-24-12-7-6-8-13-24)37-33(44)25(14-9-10-17-39(3,4)5)20-31(42)29(22-40)38-34(45)27-15-11-16-36-27/h6-8,12-13,23,25-29,36,40H,9-11,14-22H2,1-5H3,(H3-,35,37,38,43,44,45)/p+1/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | FHYKGULTOALJFD-PNHLWVRCSA-O |
| XLogP | 1.50 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.85 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|