About 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane
9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane (PubChem CID 158041677) has the molecular formula C29H25Cl2N3O6
and a molecular weight of 582.44 g/mol. Its IUPAC name is 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane.
Molecular Properties
| Compound Name | 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane |
| PubChem CID | 158041677 |
| Molecular Formula | C29H25Cl2N3O6 |
| Molecular Weight | 582.44 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane |
| SMILES | C.C.O=C(O)c1cccc([N+](=O)[O-])c1Cc1ccccc1Cl.O=C(O)c1cccc2nc3cccc(Cl)c3nc12 |
| InChI | InChI=1S/C14H10ClNO4.C13H7ClN2O2.2CH4/c15-12-6-2-1-4-9(12)8-11-10(14(17)18)5-3-7-13(11)16(19)20;14-8-4-2-6-10-12(8)16-11-7(13(17)18)3-1-5-9(11)15-10;;/h1-7H,8H2,(H,17,18);1-6H,(H,17,18);2*1H4 |
| InChIKey | FIKTXASGHPNSKL-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 143.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 582.44 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane?
The IUPAC name of 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane (CID 158041677) is 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane.
What is the SMILES notation for 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane?
The canonical SMILES for 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane is C.C.O=C(O)c1cccc([N+](=O)[O-])c1Cc1ccccc1Cl.O=C(O)c1cccc2nc3cccc(Cl)c3nc12.
What is the InChIKey of 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane?
The InChIKey is FIKTXASGHPNSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClNO4.C13H7ClN2O2.2CH4/c15-12-6-2-1-4-9(12)8-11-10(14(17)18)5-3-7-13(11)16(19)20;14-8-4-2-6-10-12(8)16-11-7(13(17)18)3-1-5-9(11)15-10;;/h1-7H,8H2,(H,17,18);1-6H,(H,17,18);2*1H4.
What are the key properties of 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane?
9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane has a molecular weight of 582.44 g/mol, XLogP of 7.94, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chlorophenazine-1-carboxylic acid;2-[(2-chlorophenyl)methyl]-3-nitrobenzoic acid;methane is sourced from PubChem (CID 158041677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).