C52H114N6 — CID 158043434
N,N'-bis(4-methylpentan-2-yl)butane-1,4-diamine;N,N'-bis(4-methylpentan-2-yl)hexane-1,6-diamine;1-N-(2,3-dimethylbutyl)-2-N-(4-methylpentan-2-yl)cyclohexane-1,2-diamine (PubChem CID 158043434) has the molecular formula C52H114N6 and a molecular weight of 823.53 g/mol. Its IUPAC name is N,N'-bis(4-methylpentan-2-yl)butane-1,4-diamine;N,N'-bis(4-methylpentan-2-yl)hexane-1,6-diamine;1-N-(2,3-dimethylbutyl)-2-N-(4-methylpentan-2-yl)cyclohexane-1,2-diamine.
| Compound Name | N,N'-bis(4-methylpentan-2-yl)butane-1,4-diamine;N,N'-bis(4-methylpentan-2-yl)hexane-1,6-diamine;1-N-(2,3-dimethylbutyl)-2-N-(4-methylpentan-2-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 158043434 |
| Molecular Formula | C52H114N6 |
| Molecular Weight | 823.53 g/mol |
| Exact Mass | 822.91 |
| IUPAC Name | N,N'-bis(4-methylpentan-2-yl)butane-1,4-diamine;N,N'-bis(4-methylpentan-2-yl)hexane-1,6-diamine;1-N-(2,3-dimethylbutyl)-2-N-(4-methylpentan-2-yl)cyclohexane-1,2-diamine |
| SMILES | CC(C)CC(C)NC1CCCCC1NCC(C)C(C)C.CC(C)CC(C)NCCCCCCNC(C)CC(C)C.CC(C)CC(C)NCCCCNC(C)CC(C)C |
| InChI | InChI=1S/C18H38N2.C18H40N2.C16H36N2/c1-13(2)11-16(6)20-18-10-8-7-9-17(18)19-12-15(5)14(3)4;1-15(2)13-17(5)19-11-9-7-8-10-12-20-18(6)14-16(3)4;1-13(2)11-15(5)17-9-7-8-10-18-16(6)12-14(3)4/h13-20H,7-12H2,1-6H3;15-20H,7-14H2,1-6H3;13-18H,7-12H2,1-6H3 |
| InChIKey | FIPYGVVORZVHKD-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.53 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|