C14H18BBrN4O — CID 158047700
5-bromo-6-methylpyridin-2-amine;N,N,6-trimethyl-5-oxoboranylpyridin-2-amine (PubChem CID 158047700) has the molecular formula C14H18BBrN4O and a molecular weight of 349.04 g/mol. Its IUPAC name is 5-bromo-6-methylpyridin-2-amine;N,N,6-trimethyl-5-oxoboranylpyridin-2-amine.
| Compound Name | 5-bromo-6-methylpyridin-2-amine;N,N,6-trimethyl-5-oxoboranylpyridin-2-amine |
|---|---|
| PubChem CID | 158047700 |
| Molecular Formula | C14H18BBrN4O |
| Molecular Weight | 349.04 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-bromo-6-methylpyridin-2-amine;N,N,6-trimethyl-5-oxoboranylpyridin-2-amine |
| SMILES | Cc1nc(N(C)C)ccc1B=O.Cc1nc(N)ccc1Br |
| InChI | InChI=1S/C8H11BN2O.C6H7BrN2/c1-6-7(9-12)4-5-8(10-6)11(2)3;1-4-5(7)2-3-6(8)9-4/h4-5H,1-3H3;2-3H,1H3,(H2,8,9) |
| InChIKey | FJCNOVYIQAYENN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.04 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|