C18H17F2NO6 — CID 158047916
2-(4-fluoro-2-methyl-5-nitrophenyl)acetic acid;2-(4-fluoro-2-methylphenyl)acetic acid (PubChem CID 158047916) has the molecular formula C18H17F2NO6 and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-(4-fluoro-2-methyl-5-nitrophenyl)acetic acid;2-(4-fluoro-2-methylphenyl)acetic acid.
| Compound Name | 2-(4-fluoro-2-methyl-5-nitrophenyl)acetic acid;2-(4-fluoro-2-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 158047916 |
| Molecular Formula | C18H17F2NO6 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-(4-fluoro-2-methyl-5-nitrophenyl)acetic acid;2-(4-fluoro-2-methylphenyl)acetic acid |
| SMILES | Cc1cc(F)c([N+](=O)[O-])cc1CC(=O)O.Cc1cc(F)ccc1CC(=O)O |
| InChI | InChI=1S/C9H8FNO4.C9H9FO2/c1-5-2-7(10)8(11(14)15)3-6(5)4-9(12)13;1-6-4-8(10)3-2-7(6)5-9(11)12/h2-3H,4H2,1H3,(H,12,13);2-4H,5H2,1H3,(H,11,12) |
| InChIKey | FJDGASWNKFLRPS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|