C23H20ClFN4O2S — CID 158048385
N-(5-chloro-2-pyridinyl)-3-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 158048385) has the molecular formula C23H20ClFN4O2S and a molecular weight of 470.96 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 158048385 |
| Molecular Formula | C23H20ClFN4O2S |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-[2-[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccsc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CCCC1 |
| InChI | InChI=1S/C23H20ClFN4O2S/c24-16-4-6-20(27-13-16)28-23(31)21-14(7-10-32-21)12-19(30)17-5-3-15(11-18(17)25)22(26)29-8-1-2-9-29/h3-7,10-11,13,26H,1-2,8-9,12H2,(H,27,28,31)/b26-22- |
| InChIKey | ZIEDGTMWAOKNGX-ROMGYVFFSA-N |
| XLogP | 5.03 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|