C20H37N3 — CID 158049344
N,6-dimethylpyridin-3-amine;ethane;N-methylaniline (PubChem CID 158049344) has the molecular formula C20H37N3 and a molecular weight of 319.54 g/mol. Its IUPAC name is N,6-dimethylpyridin-3-amine;ethane;N-methylaniline.
| Compound Name | N,6-dimethylpyridin-3-amine;ethane;N-methylaniline |
|---|---|
| PubChem CID | 158049344 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | N,6-dimethylpyridin-3-amine;ethane;N-methylaniline |
| SMILES | CC.CC.CC.CNc1ccc(C)nc1.CNc1ccccc1 |
| InChI | InChI=1S/C7H10N2.C7H9N.3C2H6/c1-6-3-4-7(8-2)5-9-6;1-8-7-5-3-2-4-6-7;3*1-2/h3-5,8H,1-2H3;2-6,8H,1H3;3*1-2H3 |
| InChIKey | FJHFDCGOTLWFFR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |