C18H16F4N2O2 — CID 158051254
N-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-(2-oxopropyl)pyridine-4-carboxamide (PubChem CID 158051254) has the molecular formula C18H16F4N2O2 and a molecular weight of 368.33 g/mol. Its IUPAC name is N-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-(2-oxopropyl)pyridine-4-carboxamide.
| Compound Name | N-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-(2-oxopropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 158051254 |
| Molecular Formula | C18H16F4N2O2 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[1-[2-fluoro-5-(trifluoromethyl)phenyl]ethyl]-2-(2-oxopropyl)pyridine-4-carboxamide |
| SMILES | CC(=O)Cc1cc(C(=O)NC(C)c2cc(C(F)(F)F)ccc2F)ccn1 |
| InChI | InChI=1S/C18H16F4N2O2/c1-10(25)7-14-8-12(5-6-23-14)17(26)24-11(2)15-9-13(18(20,21)22)3-4-16(15)19/h3-6,8-9,11H,7H2,1-2H3,(H,24,26) |
| InChIKey | FJMXUBIQFWUHJJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |