C21H19F5N2O3 — CID 158844904
2-(2-cyclopropyl-2-oxoethyl)-N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide (PubChem CID 158844904) has the molecular formula C21H19F5N2O3 and a molecular weight of 442.38 g/mol. Its IUPAC name is 2-(2-cyclopropyl-2-oxoethyl)-N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-cyclopropyl-2-oxoethyl)-N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 158844904 |
| Molecular Formula | C21H19F5N2O3 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-(2-cyclopropyl-2-oxoethyl)-N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccnc(CC(=O)C2CC2)c1)c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F5N2O3/c1-12(13-4-6-17(7-5-13)31-21(25,26)20(22,23)24)28-19(30)15-8-9-27-16(10-15)11-18(29)14-2-3-14/h4-10,12,14H,2-3,11H2,1H3,(H,28,30) |
| InChIKey | IYRVTYWWWUHWSK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|