C19H22F5N4O2- — CID 162260184
tert-butylazanide;N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyrazine-2-carboxamide (PubChem CID 162260184) has the molecular formula C19H22F5N4O2- and a molecular weight of 433.40 g/mol. Its IUPAC name is tert-butylazanide;N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyrazine-2-carboxamide.
| Compound Name | tert-butylazanide;N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 162260184 |
| Molecular Formula | C19H22F5N4O2- |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | tert-butylazanide;N-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]pyrazine-2-carboxamide |
| SMILES | CC(C)(C)[NH-].CC(NC(=O)c1cnccn1)c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F5N3O2.C4H10N/c1-9(23-13(24)12-8-21-6-7-22-12)10-2-4-11(5-3-10)25-15(19,20)14(16,17)18;1-4(2,3)5/h2-9H,1H3,(H,23,24);5H,1-3H3/q;-1 |
| InChIKey | ZZDIXYBCLZBIFP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|