C13H10F3N3O2 — CID 37039688
N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazine-2-carboxamide (PubChem CID 37039688) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 37039688 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[[4-(trifluoromethoxy)phenyl]methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)c1cnccn1 |
| InChI | InChI=1S/C13H10F3N3O2/c14-13(15,16)21-10-3-1-9(2-4-10)7-19-12(20)11-8-17-5-6-18-11/h1-6,8H,7H2,(H,19,20) |
| InChIKey | YYTWMKMWKQPUGA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |