About fluoromethane;1-methylpyrazole-4-carboxamide
fluoromethane;1-methylpyrazole-4-carboxamide (PubChem CID 158051819) has the molecular formula C6H10FN3O
and a molecular weight of 159.16 g/mol. Its IUPAC name is fluoromethane;1-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | fluoromethane;1-methylpyrazole-4-carboxamide |
| PubChem CID | 158051819 |
| Molecular Formula | C6H10FN3O |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | fluoromethane;1-methylpyrazole-4-carboxamide |
| SMILES | CF.Cn1cc(C(N)=O)cn1 |
| InChI | InChI=1S/C5H7N3O.CH3F/c1-8-3-4(2-7-8)5(6)9;1-2/h2-3H,1H3,(H2,6,9);1H3 |
| InChIKey | FJOOHFQBONBTMK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze fluoromethane;1-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;1-methylpyrazole-4-carboxamide?
The IUPAC name of fluoromethane;1-methylpyrazole-4-carboxamide (CID 158051819) is fluoromethane;1-methylpyrazole-4-carboxamide.
What is the SMILES notation for fluoromethane;1-methylpyrazole-4-carboxamide?
The canonical SMILES for fluoromethane;1-methylpyrazole-4-carboxamide is CF.Cn1cc(C(N)=O)cn1.
What is the InChIKey of fluoromethane;1-methylpyrazole-4-carboxamide?
The InChIKey is FJOOHFQBONBTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O.CH3F/c1-8-3-4(2-7-8)5(6)9;1-2/h2-3H,1H3,(H2,6,9);1H3.
What are the key properties of fluoromethane;1-methylpyrazole-4-carboxamide?
fluoromethane;1-methylpyrazole-4-carboxamide has a molecular weight of 159.16 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;1-methylpyrazole-4-carboxamide is sourced from PubChem (CID 158051819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).