C17H14F3N3O — CID 159796850
1-methylpyrazole-4-carboxamide;1,2,3-trifluoro-5-phenylbenzene (PubChem CID 159796850) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is 1-methylpyrazole-4-carboxamide;1,2,3-trifluoro-5-phenylbenzene.
| Compound Name | 1-methylpyrazole-4-carboxamide;1,2,3-trifluoro-5-phenylbenzene |
|---|---|
| PubChem CID | 159796850 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-methylpyrazole-4-carboxamide;1,2,3-trifluoro-5-phenylbenzene |
| SMILES | Cn1cc(C(N)=O)cn1.Fc1cc(-c2ccccc2)cc(F)c1F |
| InChI | InChI=1S/C12H7F3.C5H7N3O/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8;1-8-3-4(2-7-8)5(6)9/h1-7H;2-3H,1H3,(H2,6,9) |
| InChIKey | NJGZMNSNBGIFGJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|