C13H19NO3 — CID 158053906
(3-methoxy-4,5-dimethylphenyl) N-propan-2-ylcarbamate (PubChem CID 158053906) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (3-methoxy-4,5-dimethylphenyl) N-propan-2-ylcarbamate.
| Compound Name | (3-methoxy-4,5-dimethylphenyl) N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 158053906 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (3-methoxy-4,5-dimethylphenyl) N-propan-2-ylcarbamate |
| SMILES | COc1cc(OC(=O)NC(C)C)cc(C)c1C |
| InChI | InChI=1S/C13H19NO3/c1-8(2)14-13(15)17-11-6-9(3)10(4)12(7-11)16-5/h6-8H,1-5H3,(H,14,15) |
| InChIKey | SYRNGPHUSCJYRJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |