C17H22N2OV — CID 158055822
1-[4-[(6-methyl-1H-benzimidazol-2-yl)methyl]cyclohexyl]ethanone;vanadium (PubChem CID 158055822) has the molecular formula C17H22N2OV and a molecular weight of 321.32 g/mol. Its IUPAC name is 1-[4-[(6-methyl-1H-benzimidazol-2-yl)methyl]cyclohexyl]ethanone;vanadium.
| Compound Name | 1-[4-[(6-methyl-1H-benzimidazol-2-yl)methyl]cyclohexyl]ethanone;vanadium |
|---|---|
| PubChem CID | 158055822 |
| Molecular Formula | C17H22N2OV |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[4-[(6-methyl-1H-benzimidazol-2-yl)methyl]cyclohexyl]ethanone;vanadium |
| SMILES | CC(=O)C1CCC(Cc2nc3ccc(C)cc3[nH]2)CC1.[V] |
| InChI | InChI=1S/C17H22N2O.V/c1-11-3-8-15-16(9-11)19-17(18-15)10-13-4-6-14(7-5-13)12(2)20;/h3,8-9,13-14H,4-7,10H2,1-2H3,(H,18,19); |
| InChIKey | FKARCACRSJRJIJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |