C23H27N3O — CID 46290733
2-cyclopentyl-N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]acetamide (PubChem CID 46290733) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-cyclopentyl-N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46290733 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 2-cyclopentyl-N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]acetamide |
| SMILES | Cc1ccc2nc(CCc3ccc(NC(=O)CC4CCCC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C23H27N3O/c1-16-6-12-20-21(14-16)26-22(25-20)13-9-17-7-10-19(11-8-17)24-23(27)15-18-4-2-3-5-18/h6-8,10-12,14,18H,2-5,9,13,15H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | DZERBRZWUUPASH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |