C26H21N3O3 — CID 20930875
N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]-2-oxochromene-3-carboxamide (PubChem CID 20930875) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 20930875 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[4-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]phenyl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccc2nc(CCc3ccc(NC(=O)c4cc5ccccc5oc4=O)cc3)[nH]c2c1 |
| InChI | InChI=1S/C26H21N3O3/c1-16-6-12-21-22(14-16)29-24(28-21)13-9-17-7-10-19(11-8-17)27-25(30)20-15-18-4-2-3-5-23(18)32-26(20)31/h2-8,10-12,14-15H,9,13H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | YSYAUOIAWVXNLO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|