About 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine
2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine (PubChem CID 158056554) has the molecular formula C22H16ClIN2
and a molecular weight of 470.74 g/mol. Its IUPAC name is 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine.
Molecular Properties
| Compound Name | 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine |
| PubChem CID | 158056554 |
| Molecular Formula | C22H16ClIN2 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine |
| SMILES | Clc1cc(-c2ccccc2)ccn1.Ic1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C11H8ClN.C11H8IN/c2*12-11-8-10(6-7-13-11)9-4-2-1-3-5-9/h2*1-8H |
| InChIKey | FKCWTNUPNKLPRA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine?
The IUPAC name of 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine (CID 158056554) is 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine.
What is the SMILES notation for 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine?
The canonical SMILES for 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine is Clc1cc(-c2ccccc2)ccn1.Ic1cc(-c2ccccc2)ccn1.
What is the InChIKey of 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine?
The InChIKey is FKCWTNUPNKLPRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN.C11H8IN/c2*12-11-8-10(6-7-13-11)9-4-2-1-3-5-9/h2*1-8H.
What are the key properties of 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine?
2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine has a molecular weight of 470.74 g/mol, XLogP of 6.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-phenylpyridine;2-iodo-4-phenylpyridine is sourced from PubChem (CID 158056554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).