C13H15ClN2 — CID 57486336
7-(6-chloro-3-pyridinyl)-3-azabicyclo[3.3.1]non-6-ene (PubChem CID 57486336) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 7-(6-chloro-3-pyridinyl)-3-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 7-(6-chloro-3-pyridinyl)-3-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 57486336 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 7-(6-chloro-3-pyridinyl)-3-azabicyclo[3.3.1]non-6-ene |
| SMILES | Clc1ccc(C2=CC3CNCC(C2)C3)cn1 |
| InChI | InChI=1S/C13H15ClN2/c14-13-2-1-11(8-16-13)12-4-9-3-10(5-12)7-15-6-9/h1-2,4,8-10,15H,3,5-7H2 |
| InChIKey | QCSSDCOJCQOKNU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|