C11H11ClN2 — CID 87915438
(1R,5S)-4-(6-chloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-3-ene (PubChem CID 87915438) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is (1R,5S)-4-(6-chloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-3-ene.
| Compound Name | (1R,5S)-4-(6-chloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-3-ene |
|---|---|
| PubChem CID | 87915438 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (1R,5S)-4-(6-chloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-3-ene |
| SMILES | Clc1ccc(C2=CC[C@@H]3CN[C@H]23)cn1 |
| InChI | InChI=1S/C11H11ClN2/c12-10-4-2-7(5-13-10)9-3-1-8-6-14-11(8)9/h2-5,8,11,14H,1,6H2/t8-,11+/m1/s1 |
| InChIKey | YISIEWGQDALYIX-KCJUWKMLSA-N |
| XLogP | 2.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|