C14H17ClN2 — CID 87915236
(4aS,8aS)-7-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,8,8a-octahydroisoquinoline (PubChem CID 87915236) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is (4aS,8aS)-7-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,8,8a-octahydroisoquinoline.
| Compound Name | (4aS,8aS)-7-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 87915236 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (4aS,8aS)-7-(6-chloro-3-pyridinyl)-1,2,3,4,4a,5,8,8a-octahydroisoquinoline |
| SMILES | Clc1ccc(C2=CC[C@H]3CCNC[C@H]3C2)cn1 |
| InChI | InChI=1S/C14H17ClN2/c15-14-4-3-12(9-17-14)11-2-1-10-5-6-16-8-13(10)7-11/h2-4,9-10,13,16H,1,5-8H2/t10-,13+/m0/s1 |
| InChIKey | VKYYNHDDKMBONA-GXFFZTMASA-N |
| XLogP | 3.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|