C12H13BrN2 — CID 87915037
(3aR,6aS)-5-(6-bromo-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 87915037) has the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. Its IUPAC name is (3aR,6aS)-5-(6-bromo-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-5-(6-bromo-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 87915037 |
| Molecular Formula | C12H13BrN2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (3aR,6aS)-5-(6-bromo-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | Brc1ccc(C2=C[C@H]3CNC[C@H]3C2)cn1 |
| InChI | InChI=1S/C12H13BrN2/c13-12-2-1-8(7-15-12)9-3-10-5-14-6-11(10)4-9/h1-3,7,10-11,14H,4-6H2/t10-,11+/m0/s1 |
| InChIKey | DHPGXFKCRLEZRK-WDEREUQCSA-N |
| XLogP | 2.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|