C11H13NS — CID 90224764
(3aS,6aR)-5-thiophen-2-yl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 90224764) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is (3aS,6aR)-5-thiophen-2-yl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-5-thiophen-2-yl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 90224764 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (3aS,6aR)-5-thiophen-2-yl-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | C1=C(c2cccs2)C[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C11H13NS/c1-2-11(13-3-1)8-4-9-6-12-7-10(9)5-8/h1-4,9-10,12H,5-7H2/t9-,10+/m1/s1 |
| InChIKey | ZKNADTRJCGWYOL-ZJUUUORDSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |