C10H13NS — CID 69191672
2-methyl-4-thiophen-2-yl-1,2,3,6-tetrahydropyridine (PubChem CID 69191672) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-methyl-4-thiophen-2-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-methyl-4-thiophen-2-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 69191672 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-methyl-4-thiophen-2-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1CC(c2cccs2)=CCN1 |
| InChI | InChI=1S/C10H13NS/c1-8-7-9(4-5-11-8)10-3-2-6-12-10/h2-4,6,8,11H,5,7H2,1H3 |
| InChIKey | OFZNLSVJQOESMF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |