C17H18BPS3 — CID 58159738
2-(1,1-dimethyl-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl)thiophene (PubChem CID 58159738) has the molecular formula C17H18BPS3 and a molecular weight of 360.32 g/mol. Its IUPAC name is 2-(1,1-dimethyl-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl)thiophene.
| Compound Name | 2-(1,1-dimethyl-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl)thiophene |
|---|---|
| PubChem CID | 58159738 |
| Molecular Formula | C17H18BPS3 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-(1,1-dimethyl-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl)thiophene |
| SMILES | C[P+]1(C)CC=C(c2cccs2)[B-]1(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H18BPS3/c1-19(2)10-9-14(15-6-3-11-20-15)18(19,16-7-4-12-21-16)17-8-5-13-22-17/h3-9,11-13H,10H2,1-2H3 |
| InChIKey | TYMVPWOIVSHADP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|