C24H24BPS3 — CID 58160102
2-[1,1-dimethyl-4-(4-methylphenyl)-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl]thiophene (PubChem CID 58160102) has the molecular formula C24H24BPS3 and a molecular weight of 450.44 g/mol. Its IUPAC name is 2-[1,1-dimethyl-4-(4-methylphenyl)-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl]thiophene.
| Compound Name | 2-[1,1-dimethyl-4-(4-methylphenyl)-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl]thiophene |
|---|---|
| PubChem CID | 58160102 |
| Molecular Formula | C24H24BPS3 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-[1,1-dimethyl-4-(4-methylphenyl)-2,2-dithiophen-2-yl-1-phosphonia-2-boranuidacyclopent-3-en-3-yl]thiophene |
| SMILES | Cc1ccc(C2=C(c3cccs3)[B-](c3cccs3)(c3cccs3)[P+](C)(C)C2)cc1 |
| InChI | InChI=1S/C24H24BPS3/c1-18-10-12-19(13-11-18)20-17-26(2,3)25(22-8-5-15-28-22,23-9-6-16-29-23)24(20)21-7-4-14-27-21/h4-16H,17H2,1-3H3 |
| InChIKey | REXTUUQQLSZWHE-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|