C17H14S2 — CID 139982091
2-(4-prop-1-en-2-ylphenyl)-5-thiophen-2-ylthiophene (PubChem CID 139982091) has the molecular formula C17H14S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-(4-prop-1-en-2-ylphenyl)-5-thiophen-2-ylthiophene.
| Compound Name | 2-(4-prop-1-en-2-ylphenyl)-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 139982091 |
| Molecular Formula | C17H14S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-(4-prop-1-en-2-ylphenyl)-5-thiophen-2-ylthiophene |
| SMILES | C=C(C)c1ccc(-c2ccc(-c3cccs3)s2)cc1 |
| InChI | InChI=1S/C17H14S2/c1-12(2)13-5-7-14(8-6-13)15-9-10-17(19-15)16-4-3-11-18-16/h3-11H,1H2,2H3 |
| InChIKey | WRIMERLYWUCIQQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |