C18H20BNS3 — CID 58159955
1,1,4-trimethyl-2,2,3-trithiophen-2-yl-1-azonia-2-boranuidacyclopent-3-ene (PubChem CID 58159955) has the molecular formula C18H20BNS3 and a molecular weight of 357.38 g/mol. Its IUPAC name is 1,1,4-trimethyl-2,2,3-trithiophen-2-yl-1-azonia-2-boranuidacyclopent-3-ene.
| Compound Name | 1,1,4-trimethyl-2,2,3-trithiophen-2-yl-1-azonia-2-boranuidacyclopent-3-ene |
|---|---|
| PubChem CID | 58159955 |
| Molecular Formula | C18H20BNS3 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1,1,4-trimethyl-2,2,3-trithiophen-2-yl-1-azonia-2-boranuidacyclopent-3-ene |
| SMILES | CC1=C(c2cccs2)[B-](c2cccs2)(c2cccs2)[N+](C)(C)C1 |
| InChI | InChI=1S/C18H20BNS3/c1-14-13-20(2,3)19(16-8-5-11-22-16,17-9-6-12-23-17)18(14)15-7-4-10-21-15/h4-12H,13H2,1-3H3 |
| InChIKey | IZTMRHPVUIRPED-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|