C24H25NS2 — CID 102441175
1-[2,6-di(propan-2-yl)phenyl]-2,5-dithiophen-2-ylpyrrole (PubChem CID 102441175) has the molecular formula C24H25NS2 and a molecular weight of 391.61 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2,5-dithiophen-2-ylpyrrole.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2,5-dithiophen-2-ylpyrrole |
|---|---|
| PubChem CID | 102441175 |
| Molecular Formula | C24H25NS2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2,5-dithiophen-2-ylpyrrole |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2cccs2)ccc1-c1cccs1 |
| InChI | InChI=1S/C24H25NS2/c1-16(2)18-8-5-9-19(17(3)4)24(18)25-20(22-10-6-14-26-22)12-13-21(25)23-11-7-15-27-23/h5-17H,1-4H3 |
| InChIKey | XINBLYYNAWBEFE-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |