C18H8F5NS2 — CID 101416590
1-(2,3,4,5,6-pentafluorophenyl)-2,5-dithiophen-2-ylpyrrole (PubChem CID 101416590) has the molecular formula C18H8F5NS2 and a molecular weight of 397.39 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-2,5-dithiophen-2-ylpyrrole.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-2,5-dithiophen-2-ylpyrrole |
|---|---|
| PubChem CID | 101416590 |
| Molecular Formula | C18H8F5NS2 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-2,5-dithiophen-2-ylpyrrole |
| SMILES | Fc1c(F)c(F)c(-n2c(-c3cccs3)ccc2-c2cccs2)c(F)c1F |
| InChI | InChI=1S/C18H8F5NS2/c19-13-14(20)16(22)18(17(23)15(13)21)24-9(11-3-1-7-25-11)5-6-10(24)12-4-2-8-26-12/h1-8H |
| InChIKey | MHLKYJCFIBHIJK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|