C30H22N2S4 — CID 139190557
1-prop-2-ynyl-2,5-dithiophen-2-ylpyrrole (PubChem CID 139190557) has the molecular formula C30H22N2S4 and a molecular weight of 538.79 g/mol. Its IUPAC name is 1-prop-2-ynyl-2,5-dithiophen-2-ylpyrrole.
| Compound Name | 1-prop-2-ynyl-2,5-dithiophen-2-ylpyrrole |
|---|---|
| PubChem CID | 139190557 |
| Molecular Formula | C30H22N2S4 |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 1-prop-2-ynyl-2,5-dithiophen-2-ylpyrrole |
| SMILES | C#CCn1c(-c2cccs2)ccc1-c1cccs1.C#CCn1c(-c2cccs2)ccc1-c1cccs1 |
| InChI | InChI=1S/2C15H11NS2/c2*1-2-9-16-12(14-5-3-10-17-14)7-8-13(16)15-6-4-11-18-15/h2*1,3-8,10-11H,9H2 |
| InChIKey | BCJHNTHCPHQXFY-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|