C15H16NO3PS2 — CID 68763160
3-(2,5-dithiophen-2-ylpyrrol-1-yl)propylphosphonic acid (PubChem CID 68763160) has the molecular formula C15H16NO3PS2 and a molecular weight of 353.41 g/mol. Its IUPAC name is 3-(2,5-dithiophen-2-ylpyrrol-1-yl)propylphosphonic acid.
| Compound Name | 3-(2,5-dithiophen-2-ylpyrrol-1-yl)propylphosphonic acid |
|---|---|
| PubChem CID | 68763160 |
| Molecular Formula | C15H16NO3PS2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 3-(2,5-dithiophen-2-ylpyrrol-1-yl)propylphosphonic acid |
| SMILES | O=P(O)(O)CCCn1c(-c2cccs2)ccc1-c1cccs1 |
| InChI | InChI=1S/C15H16NO3PS2/c17-20(18,19)9-3-8-16-12(14-4-1-10-21-14)6-7-13(16)15-5-2-11-22-15/h1-2,4-7,10-11H,3,8-9H2,(H2,17,18,19) |
| InChIKey | RRAKHIKYTSYREH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|