C17H15NO2S — CID 3584418
2-[1-(3-methylphenyl)-5-thiophen-2-ylpyrrol-2-yl]acetic acid (PubChem CID 3584418) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[1-(3-methylphenyl)-5-thiophen-2-ylpyrrol-2-yl]acetic acid.
| Compound Name | 2-[1-(3-methylphenyl)-5-thiophen-2-ylpyrrol-2-yl]acetic acid |
|---|---|
| PubChem CID | 3584418 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[1-(3-methylphenyl)-5-thiophen-2-ylpyrrol-2-yl]acetic acid |
| SMILES | Cc1cccc(-n2c(CC(=O)O)ccc2-c2cccs2)c1 |
| InChI | InChI=1S/C17H15NO2S/c1-12-4-2-5-13(10-12)18-14(11-17(19)20)7-8-15(18)16-6-3-9-21-16/h2-10H,11H2,1H3,(H,19,20) |
| InChIKey | WJCMCTOCBDRATH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|