C16H13N3S2 — CID 7112686
4-(3-methylphenyl)-3-prop-2-ynylsulfanyl-5-thiophen-2-yl-1,2,4-triazole (PubChem CID 7112686) has the molecular formula C16H13N3S2 and a molecular weight of 311.44 g/mol. Its IUPAC name is 4-(3-methylphenyl)-3-prop-2-ynylsulfanyl-5-thiophen-2-yl-1,2,4-triazole.
| Compound Name | 4-(3-methylphenyl)-3-prop-2-ynylsulfanyl-5-thiophen-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 7112686 |
| Molecular Formula | C16H13N3S2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-(3-methylphenyl)-3-prop-2-ynylsulfanyl-5-thiophen-2-yl-1,2,4-triazole |
| SMILES | C#CCSc1nnc(-c2cccs2)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C16H13N3S2/c1-3-9-21-16-18-17-15(14-8-5-10-20-14)19(16)13-7-4-6-12(2)11-13/h1,4-8,10-11H,9H2,2H3 |
| InChIKey | MLRQFOWWHUHUKP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|