C16H12O3S — CID 12925017
2-(5-methyl-3-oxo-1-thiophen-2-ylinden-2-yl)acetic acid (PubChem CID 12925017) has the molecular formula C16H12O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(5-methyl-3-oxo-1-thiophen-2-ylinden-2-yl)acetic acid.
| Compound Name | 2-(5-methyl-3-oxo-1-thiophen-2-ylinden-2-yl)acetic acid |
|---|---|
| PubChem CID | 12925017 |
| Molecular Formula | C16H12O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(5-methyl-3-oxo-1-thiophen-2-ylinden-2-yl)acetic acid |
| SMILES | Cc1ccc2c(c1)C(=O)C(CC(=O)O)=C2c1cccs1 |
| InChI | InChI=1S/C16H12O3S/c1-9-4-5-10-11(7-9)16(19)12(8-14(17)18)15(10)13-3-2-6-20-13/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | ORJGWDREFCDCRP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |