C19H14O2S4 — CID 90139364
2-[2-[5-(3-methyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetic acid (PubChem CID 90139364) has the molecular formula C19H14O2S4 and a molecular weight of 402.59 g/mol. Its IUPAC name is 2-[2-[5-(3-methyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetic acid.
| Compound Name | 2-[2-[5-(3-methyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetic acid |
|---|---|
| PubChem CID | 90139364 |
| Molecular Formula | C19H14O2S4 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 2-[2-[5-(3-methyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-3-yl]acetic acid |
| SMILES | Cc1cc(-c2cccs2)sc1-c1ccc(-c2sccc2CC(=O)O)s1 |
| InChI | InChI=1S/C19H14O2S4/c1-11-9-16(13-3-2-7-22-13)25-18(11)14-4-5-15(24-14)19-12(6-8-23-19)10-17(20)21/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | LAPYUFDAOFOFNG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |