C7H9N2O2S+ — CID 23796287
1,3-dihydroxy-5-thiophen-2-yl-2,4-dihydroimidazol-1-ium (PubChem CID 23796287) has the molecular formula C7H9N2O2S+ and a molecular weight of 185.23 g/mol. Its IUPAC name is 1,3-dihydroxy-5-thiophen-2-yl-2,4-dihydroimidazol-1-ium.
| Compound Name | 1,3-dihydroxy-5-thiophen-2-yl-2,4-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 23796287 |
| Molecular Formula | C7H9N2O2S+ |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 1,3-dihydroxy-5-thiophen-2-yl-2,4-dihydroimidazol-1-ium |
| SMILES | ON1CC(c2cccs2)=[N+](O)C1 |
| InChI | InChI=1S/C7H9N2O2S/c10-8-4-6(9(11)5-8)7-2-1-3-12-7/h1-3,10-11H,4-5H2/q+1 |
| InChIKey | PSJFBQYVBWZPQS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 46.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|